C9H15NO2S2 — CID 137495369
[(1S,3S)-3-methylsulfonylcyclohexyl]methyl thiocyanate (PubChem CID 137495369) has the molecular formula C9H15NO2S2 and a molecular weight of 233.36 g/mol. Its IUPAC name is [(1S,3S)-3-methylsulfonylcyclohexyl]methyl thiocyanate.
| Compound Name | [(1S,3S)-3-methylsulfonylcyclohexyl]methyl thiocyanate |
|---|---|
| PubChem CID | 137495369 |
| Molecular Formula | C9H15NO2S2 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | [(1S,3S)-3-methylsulfonylcyclohexyl]methyl thiocyanate |
| SMILES | CS(=O)(=O)[C@H]1CCC[C@H](CSC#N)C1 |
| InChI | InChI=1S/C9H15NO2S2/c1-14(11,12)9-4-2-3-8(5-9)6-13-7-10/h8-9H,2-6H2,1H3/t8-,9-/m0/s1 |
| InChIKey | FJVDOYQUMUCGNT-IUCAKERBSA-N |
| XLogP | 1.80 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|