C27H15Cl2N3O — CID 137496487
2-(6,8-dichlorodibenzofuran-2-yl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 137496487) has the molecular formula C27H15Cl2N3O and a molecular weight of 468.34 g/mol. Its IUPAC name is 2-(6,8-dichlorodibenzofuran-2-yl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(6,8-dichlorodibenzofuran-2-yl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 137496487 |
| Molecular Formula | C27H15Cl2N3O |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | 2-(6,8-dichlorodibenzofuran-2-yl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | Clc1cc(Cl)c2oc3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3c2c1 |
| InChI | InChI=1S/C27H15Cl2N3O/c28-19-14-21-20-13-18(11-12-23(20)33-24(21)22(29)15-19)27-31-25(16-7-3-1-4-8-16)30-26(32-27)17-9-5-2-6-10-17/h1-15H |
| InChIKey | PIFCANGYGNMYLA-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |