C23H34N4O6 — CID 137497754
benzyl-[(2S)-4-methyl-1-[[(2S)-4-methyl-1-oxo-1-[2-(2-oxopropanoyl)hydrazinyl]pentan-2-yl]amino]-1-oxopentan-2-yl]carbamic acid (PubChem CID 137497754) has the molecular formula C23H34N4O6 and a molecular weight of 462.55 g/mol. Its IUPAC name is benzyl-[(2S)-4-methyl-1-[[(2S)-4-methyl-1-oxo-1-[2-(2-oxopropanoyl)hydrazinyl]pentan-2-yl]amino]-1-oxopentan-2-yl]carbamic acid.
| Compound Name | benzyl-[(2S)-4-methyl-1-[[(2S)-4-methyl-1-oxo-1-[2-(2-oxopropanoyl)hydrazinyl]pentan-2-yl]amino]-1-oxopentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 137497754 |
| Molecular Formula | C23H34N4O6 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | benzyl-[(2S)-4-methyl-1-[[(2S)-4-methyl-1-oxo-1-[2-(2-oxopropanoyl)hydrazinyl]pentan-2-yl]amino]-1-oxopentan-2-yl]carbamic acid |
| SMILES | CC(=O)C(=O)NNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)N(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H34N4O6/c1-14(2)11-18(21(30)26-25-20(29)16(5)28)24-22(31)19(12-15(3)4)27(23(32)33)13-17-9-7-6-8-10-17/h6-10,14-15,18-19H,11-13H2,1-5H3,(H,24,31)(H,25,29)(H,26,30)(H,32,33)/t18-,19-/m0/s1 |
| InChIKey | GGOUWBPGRDFGMJ-OALUTQOASA-N |
| XLogP | 1.85 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|