C16H23N5O4S — CID 137499940
N-(2-hydroxyethyl)-3-methyl-4-[2-(oxan-2-ylmethyl)tetrazol-5-yl]benzenesulfonamide (PubChem CID 137499940) has the molecular formula C16H23N5O4S and a molecular weight of 381.46 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-3-methyl-4-[2-(oxan-2-ylmethyl)tetrazol-5-yl]benzenesulfonamide.
| Compound Name | N-(2-hydroxyethyl)-3-methyl-4-[2-(oxan-2-ylmethyl)tetrazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 137499940 |
| Molecular Formula | C16H23N5O4S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N-(2-hydroxyethyl)-3-methyl-4-[2-(oxan-2-ylmethyl)tetrazol-5-yl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCO)ccc1-c1nnn(CC2CCCCO2)n1 |
| InChI | InChI=1S/C16H23N5O4S/c1-12-10-14(26(23,24)17-7-8-22)5-6-15(12)16-18-20-21(19-16)11-13-4-2-3-9-25-13/h5-6,10,13,17,22H,2-4,7-9,11H2,1H3 |
| InChIKey | BZHUMMLRNOCUEB-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |