C21H26N6O2 — CID 1375289
3-[(S)-(1-cyclopentyltetrazol-5-yl)-pyrrolidin-1-ylmethyl]-7-methoxy-1H-quinolin-2-one (PubChem CID 1375289) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 3-[(S)-(1-cyclopentyltetrazol-5-yl)-pyrrolidin-1-ylmethyl]-7-methoxy-1H-quinolin-2-one.
| Compound Name | 3-[(S)-(1-cyclopentyltetrazol-5-yl)-pyrrolidin-1-ylmethyl]-7-methoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 1375289 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 3-[(S)-(1-cyclopentyltetrazol-5-yl)-pyrrolidin-1-ylmethyl]-7-methoxy-1H-quinolin-2-one |
| SMILES | COc1ccc2cc([C@@H](c3nnnn3C3CCCC3)N3CCCC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C21H26N6O2/c1-29-16-9-8-14-12-17(21(28)22-18(14)13-16)19(26-10-4-5-11-26)20-23-24-25-27(20)15-6-2-3-7-15/h8-9,12-13,15,19H,2-7,10-11H2,1H3,(H,22,28)/t19-/m0/s1 |
| InChIKey | PDGGJPCSRICZTB-IBGZPJMESA-N |
| XLogP | 2.82 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |