C26H20INO2 — CID 1376097
(15S,19R)-17-(4-iodo-2-methylphenyl)-1-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 1376097) has the molecular formula C26H20INO2 and a molecular weight of 505.36 g/mol. Its IUPAC name is (15S,19R)-17-(4-iodo-2-methylphenyl)-1-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15S,19R)-17-(4-iodo-2-methylphenyl)-1-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 1376097 |
| Molecular Formula | C26H20INO2 |
| Molecular Weight | 505.36 g/mol |
| Exact Mass | 505.05 |
| IUPAC Name | (15S,19R)-17-(4-iodo-2-methylphenyl)-1-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | Cc1cc(I)ccc1N1C(=O)[C@@H]2C3c4ccccc4C(C)(c4ccccc43)[C@H]2C1=O |
| InChI | InChI=1S/C26H20INO2/c1-14-13-15(27)11-12-20(14)28-24(29)22-21-16-7-3-5-9-18(16)26(2,23(22)25(28)30)19-10-6-4-8-17(19)21/h3-13,21-23H,1-2H3/t21?,22-,23-,26?/m1/s1 |
| InChIKey | HVPWELQBHMGCFA-QQNJPBSNSA-N |
| XLogP | 5.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.36 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|