C21H26N2 — CID 1376911
1-[(3-methylphenyl)methyl]-4-[(E)-3-phenylprop-2-enyl]piperazine (PubChem CID 1376911) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-[(3-methylphenyl)methyl]-4-[(E)-3-phenylprop-2-enyl]piperazine.
| Compound Name | 1-[(3-methylphenyl)methyl]-4-[(E)-3-phenylprop-2-enyl]piperazine |
|---|---|
| PubChem CID | 1376911 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 1-[(3-methylphenyl)methyl]-4-[(E)-3-phenylprop-2-enyl]piperazine |
| SMILES | Cc1cccc(CN2CCN(C/C=C/c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H26N2/c1-19-7-5-10-21(17-19)18-23-15-13-22(14-16-23)12-6-11-20-8-3-2-4-9-20/h2-11,17H,12-16,18H2,1H3/b11-6+ |
| InChIKey | KXRADLKLVCTABH-IZZDOVSWSA-N |
| XLogP | 3.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |