C25H30N2O3 — CID 6734987
3-[(3-methylphenyl)methyl]-4-oxo-4-[4-(3-phenylprop-2-enyl)piperazin-1-yl]butanoic acid (PubChem CID 6734987) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is 3-[(3-methylphenyl)methyl]-4-oxo-4-[4-(3-phenylprop-2-enyl)piperazin-1-yl]butanoic acid.
| Compound Name | 3-[(3-methylphenyl)methyl]-4-oxo-4-[4-(3-phenylprop-2-enyl)piperazin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 6734987 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 3-[(3-methylphenyl)methyl]-4-oxo-4-[4-(3-phenylprop-2-enyl)piperazin-1-yl]butanoic acid |
| SMILES | Cc1cccc(CC(CC(=O)O)C(=O)N2CCN(CC=Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C25H30N2O3/c1-20-7-5-10-22(17-20)18-23(19-24(28)29)25(30)27-15-13-26(14-16-27)12-6-11-21-8-3-2-4-9-21/h2-11,17,23H,12-16,18-19H2,1H3,(H,28,29) |
| InChIKey | MNWWUVMIMOJZDN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |