C23H27NO — CID 1378388
2-methoxy-5-phenyl-N-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]aniline (PubChem CID 1378388) has the molecular formula C23H27NO and a molecular weight of 333.48 g/mol. Its IUPAC name is 2-methoxy-5-phenyl-N-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]aniline.
| Compound Name | 2-methoxy-5-phenyl-N-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 1378388 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 2-methoxy-5-phenyl-N-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]aniline |
| SMILES | C=C(C)[C@@H]1CC=C(CNc2cc(-c3ccccc3)ccc2OC)CC1 |
| InChI | InChI=1S/C23H27NO/c1-17(2)19-11-9-18(10-12-19)16-24-22-15-21(13-14-23(22)25-3)20-7-5-4-6-8-20/h4-9,13-15,19,24H,1,10-12,16H2,2-3H3/t19-/m1/s1 |
| InChIKey | IXCLVKWOKRTLDE-LJQANCHMSA-N |
| XLogP | 6.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|