C20H20N4OS — CID 5006922
1,1-bis(2-cyanoethyl)-3-(2-methoxy-5-phenylphenyl)thiourea (PubChem CID 5006922) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is 1,1-bis(2-cyanoethyl)-3-(2-methoxy-5-phenylphenyl)thiourea.
| Compound Name | 1,1-bis(2-cyanoethyl)-3-(2-methoxy-5-phenylphenyl)thiourea |
|---|---|
| PubChem CID | 5006922 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1,1-bis(2-cyanoethyl)-3-(2-methoxy-5-phenylphenyl)thiourea |
| SMILES | COc1ccc(-c2ccccc2)cc1NC(=S)N(CCC#N)CCC#N |
| InChI | InChI=1S/C20H20N4OS/c1-25-19-10-9-17(16-7-3-2-4-8-16)15-18(19)23-20(26)24(13-5-11-21)14-6-12-22/h2-4,7-10,15H,5-6,13-14H2,1H3,(H,23,26) |
| InChIKey | FGORGJFJSIOAFC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|