C21H23N3O2S — CID 23908367
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(2-methoxy-5-phenylphenyl)thiourea (PubChem CID 23908367) has the molecular formula C21H23N3O2S and a molecular weight of 381.50 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(2-methoxy-5-phenylphenyl)thiourea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(2-methoxy-5-phenylphenyl)thiourea |
|---|---|
| PubChem CID | 23908367 |
| Molecular Formula | C21H23N3O2S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-(2-methoxy-5-phenylphenyl)thiourea |
| SMILES | COc1ccc(-c2ccccc2)cc1NC(=S)Nc1cc(C(C)(C)C)on1 |
| InChI | InChI=1S/C21H23N3O2S/c1-21(2,3)18-13-19(24-26-18)23-20(27)22-16-12-15(10-11-17(16)25-4)14-8-6-5-7-9-14/h5-13H,1-4H3,(H2,22,23,24,27) |
| InChIKey | LLQPYSSHKAPPFJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|