C12H13N3O2S — CID 19686879
1-(2-methoxy-5-methylphenyl)-3-(1,2-oxazol-3-yl)thiourea (PubChem CID 19686879) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-3-(1,2-oxazol-3-yl)thiourea.
| Compound Name | 1-(2-methoxy-5-methylphenyl)-3-(1,2-oxazol-3-yl)thiourea |
|---|---|
| PubChem CID | 19686879 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-3-(1,2-oxazol-3-yl)thiourea |
| SMILES | COc1ccc(C)cc1NC(=S)Nc1ccon1 |
| InChI | InChI=1S/C12H13N3O2S/c1-8-3-4-10(16-2)9(7-8)13-12(18)14-11-5-6-17-15-11/h3-7H,1-2H3,(H2,13,14,15,18) |
| InChIKey | NCBRMNRJOMMLKK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|