C14H22N2O3S — CID 3249140
1-(1,1-dimethoxypropan-2-yl)-3-(2-methoxy-5-methylphenyl)thiourea (PubChem CID 3249140) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 1-(1,1-dimethoxypropan-2-yl)-3-(2-methoxy-5-methylphenyl)thiourea.
| Compound Name | 1-(1,1-dimethoxypropan-2-yl)-3-(2-methoxy-5-methylphenyl)thiourea |
|---|---|
| PubChem CID | 3249140 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-(1,1-dimethoxypropan-2-yl)-3-(2-methoxy-5-methylphenyl)thiourea |
| SMILES | COc1ccc(C)cc1NC(=S)NC(C)C(OC)OC |
| InChI | InChI=1S/C14H22N2O3S/c1-9-6-7-12(17-3)11(8-9)16-14(20)15-10(2)13(18-4)19-5/h6-8,10,13H,1-5H3,(H2,15,16,20) |
| InChIKey | ZYCUQSWTHASGOM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|