C11H11N3O2S — CID 19686853
1-(4-methoxyphenyl)-3-(1,2-oxazol-3-yl)thiourea (PubChem CID 19686853) has the molecular formula C11H11N3O2S and a molecular weight of 249.30 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-(1,2-oxazol-3-yl)thiourea.
| Compound Name | 1-(4-methoxyphenyl)-3-(1,2-oxazol-3-yl)thiourea |
|---|---|
| PubChem CID | 19686853 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-(1,2-oxazol-3-yl)thiourea |
| SMILES | COc1ccc(NC(=S)Nc2ccon2)cc1 |
| InChI | InChI=1S/C11H11N3O2S/c1-15-9-4-2-8(3-5-9)12-11(17)13-10-6-7-16-14-10/h2-7H,1H3,(H2,12,13,14,17) |
| InChIKey | MCISUFLGBUACES-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|