C20H16F6N2O2 — CID 1379548
2,2,2-trifluoro-N-[(2R,4R)-2-methyl-1-(2,2,2-trifluoroacetyl)-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide (PubChem CID 1379548) has the molecular formula C20H16F6N2O2 and a molecular weight of 430.35 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2R,4R)-2-methyl-1-(2,2,2-trifluoroacetyl)-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2R,4R)-2-methyl-1-(2,2,2-trifluoroacetyl)-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 1379548 |
| Molecular Formula | C20H16F6N2O2 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2R,4R)-2-methyl-1-(2,2,2-trifluoroacetyl)-3,4-dihydro-2H-quinolin-4-yl]-N-phenylacetamide |
| SMILES | C[C@@H]1C[C@@H](N(C(=O)C(F)(F)F)c2ccccc2)c2ccccc2N1C(=O)C(F)(F)F |
| InChI | InChI=1S/C20H16F6N2O2/c1-12-11-16(28(18(30)20(24,25)26)13-7-3-2-4-8-13)14-9-5-6-10-15(14)27(12)17(29)19(21,22)23/h2-10,12,16H,11H2,1H3/t12-,16-/m1/s1 |
| InChIKey | KCPQVHRXMBHNNK-MLGOLLRUSA-N |
| XLogP | 5.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |