C25H22F3N3O2 — CID 92508835
N'-[(2R,4R)-1-benzoyl-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-2,2,2-trifluoro-N'-phenylacetohydrazide (PubChem CID 92508835) has the molecular formula C25H22F3N3O2 and a molecular weight of 453.46 g/mol. Its IUPAC name is N'-[(2R,4R)-1-benzoyl-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-2,2,2-trifluoro-N'-phenylacetohydrazide.
| Compound Name | N'-[(2R,4R)-1-benzoyl-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-2,2,2-trifluoro-N'-phenylacetohydrazide |
|---|---|
| PubChem CID | 92508835 |
| Molecular Formula | C25H22F3N3O2 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | N'-[(2R,4R)-1-benzoyl-2-methyl-3,4-dihydro-2H-quinolin-4-yl]-2,2,2-trifluoro-N'-phenylacetohydrazide |
| SMILES | C[C@@H]1C[C@@H](N(NC(=O)C(F)(F)F)c2ccccc2)c2ccccc2N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H22F3N3O2/c1-17-16-22(31(19-12-6-3-7-13-19)29-24(33)25(26,27)28)20-14-8-9-15-21(20)30(17)23(32)18-10-4-2-5-11-18/h2-15,17,22H,16H2,1H3,(H,29,33)/t17-,22-/m1/s1 |
| InChIKey | BAMJKXHZEOGFMC-VGOFRKELSA-N |
| XLogP | 5.27 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|