C21H8N4O3 — CID 1379855
11,16,18-trioxo-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-6-carbonitrile (PubChem CID 1379855) has the molecular formula C21H8N4O3 and a molecular weight of 364.32 g/mol. Its IUPAC name is 11,16,18-trioxo-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-6-carbonitrile.
| Compound Name | 11,16,18-trioxo-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-6-carbonitrile |
|---|---|
| PubChem CID | 1379855 |
| Molecular Formula | C21H8N4O3 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 11,16,18-trioxo-3,10,17-triazahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2,4(9),5,7,12,14,19(23),20-nonaene-6-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)nc1c3ccc4c5c(ccc(c(=O)n21)c53)C(=O)NC4=O |
| InChI | InChI=1S/C21H8N4O3/c22-8-9-1-6-15-14(7-9)23-18-10-2-3-11-17-12(20(27)24-19(11)26)4-5-13(16(10)17)21(28)25(15)18/h1-7H,(H,24,26,27) |
| InChIKey | TVYODWQVOOOSCM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|