C16H20N2O4S2 — CID 138001360
3-[2-(4-methyl-1,3-thiazol-2-yl)butan-2-ylsulfamoylmethyl]benzoic acid (PubChem CID 138001360) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 3-[2-(4-methyl-1,3-thiazol-2-yl)butan-2-ylsulfamoylmethyl]benzoic acid.
| Compound Name | 3-[2-(4-methyl-1,3-thiazol-2-yl)butan-2-ylsulfamoylmethyl]benzoic acid |
|---|---|
| PubChem CID | 138001360 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 3-[2-(4-methyl-1,3-thiazol-2-yl)butan-2-ylsulfamoylmethyl]benzoic acid |
| SMILES | CCC(C)(NS(=O)(=O)Cc1cccc(C(=O)O)c1)c1nc(C)cs1 |
| InChI | InChI=1S/C16H20N2O4S2/c1-4-16(3,15-17-11(2)9-23-15)18-24(21,22)10-12-6-5-7-13(8-12)14(19)20/h5-9,18H,4,10H2,1-3H3,(H,19,20) |
| InChIKey | WFXJKEFQRWROCA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |