About 3-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]carbamoylamino]benzamide
3-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]carbamoylamino]benzamide (PubChem CID 97025274) has the molecular formula C16H20N4O2S
and a molecular weight of 332.43 g/mol. Its IUPAC name is 3-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]carbamoylamino]benzamide.
Molecular Properties
| Compound Name | 3-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]carbamoylamino]benzamide |
| PubChem CID | 97025274 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]carbamoylamino]benzamide |
| SMILES | CC[C@](C)(NC(=O)Nc1cccc(C(N)=O)c1)c1nc(C)cs1 |
| InChI | InChI=1S/C16H20N4O2S/c1-4-16(3,14-18-10(2)9-23-14)20-15(22)19-12-7-5-6-11(8-12)13(17)21/h5-9H,4H2,1-3H3,(H2,17,21)(H2,19,20,22)/t16-/m0/s1 |
| InChIKey | QRYPODKTAOYAKP-INIZCTEOSA-N |
| XLogP | 3.00 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]carbamoylamino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]carbamoylamino]benzamide?
The IUPAC name of 3-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]carbamoylamino]benzamide (CID 97025274) is 3-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]carbamoylamino]benzamide.
What is the SMILES notation for 3-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]carbamoylamino]benzamide?
The canonical SMILES for 3-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]carbamoylamino]benzamide is CC[C@](C)(NC(=O)Nc1cccc(C(N)=O)c1)c1nc(C)cs1.
What is the InChIKey of 3-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]carbamoylamino]benzamide?
The InChIKey is QRYPODKTAOYAKP-INIZCTEOSA-N. The full InChI is InChI=1S/C16H20N4O2S/c1-4-16(3,14-18-10(2)9-23-14)20-15(22)19-12-7-5-6-11(8-12)13(17)21/h5-9H,4H2,1-3H3,(H2,17,21)(H2,19,20,22)/t16-/m0/s1.
What are the key properties of 3-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]carbamoylamino]benzamide?
3-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]carbamoylamino]benzamide has a molecular weight of 332.43 g/mol, XLogP of 3.00, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2S)-2-(4-methyl-1,3-thiazol-2-yl)butan-2-yl]carbamoylamino]benzamide is sourced from PubChem (CID 97025274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).