C17H22N2O3 — CID 138002572
2,2-dimethyl-N-(7-oxoazepan-4-yl)-3H-1-benzofuran-5-carboxamide (PubChem CID 138002572) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2,2-dimethyl-N-(7-oxoazepan-4-yl)-3H-1-benzofuran-5-carboxamide.
| Compound Name | 2,2-dimethyl-N-(7-oxoazepan-4-yl)-3H-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 138002572 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2,2-dimethyl-N-(7-oxoazepan-4-yl)-3H-1-benzofuran-5-carboxamide |
| SMILES | CC1(C)Cc2cc(C(=O)NC3CCNC(=O)CC3)ccc2O1 |
| InChI | InChI=1S/C17H22N2O3/c1-17(2)10-12-9-11(3-5-14(12)22-17)16(21)19-13-4-6-15(20)18-8-7-13/h3,5,9,13H,4,6-8,10H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | RJSTZBDWNMLHSL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |