C14H17F2N3O3 — CID 167781525
2-(2,2-difluoroethoxy)-N-(7-oxoazepan-4-yl)pyridine-4-carboxamide (PubChem CID 167781525) has the molecular formula C14H17F2N3O3 and a molecular weight of 313.30 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-N-(7-oxoazepan-4-yl)pyridine-4-carboxamide.
| Compound Name | 2-(2,2-difluoroethoxy)-N-(7-oxoazepan-4-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 167781525 |
| Molecular Formula | C14H17F2N3O3 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-N-(7-oxoazepan-4-yl)pyridine-4-carboxamide |
| SMILES | O=C1CCC(NC(=O)c2ccnc(OCC(F)F)c2)CCN1 |
| InChI | InChI=1S/C14H17F2N3O3/c15-11(16)8-22-13-7-9(3-5-18-13)14(21)19-10-1-2-12(20)17-6-4-10/h3,5,7,10-11H,1-2,4,6,8H2,(H,17,20)(H,19,21) |
| InChIKey | QTIOKGTVXBMBTE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |