C16H16F2N4O2 — CID 138055821
1-(3,5-difluorophenyl)-N-(7-oxoazepan-4-yl)pyrazole-3-carboxamide (PubChem CID 138055821) has the molecular formula C16H16F2N4O2 and a molecular weight of 334.33 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-N-(7-oxoazepan-4-yl)pyrazole-3-carboxamide.
| Compound Name | 1-(3,5-difluorophenyl)-N-(7-oxoazepan-4-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 138055821 |
| Molecular Formula | C16H16F2N4O2 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 1-(3,5-difluorophenyl)-N-(7-oxoazepan-4-yl)pyrazole-3-carboxamide |
| SMILES | O=C1CCC(NC(=O)c2ccn(-c3cc(F)cc(F)c3)n2)CCN1 |
| InChI | InChI=1S/C16H16F2N4O2/c17-10-7-11(18)9-13(8-10)22-6-4-14(21-22)16(24)20-12-1-2-15(23)19-5-3-12/h4,6-9,12H,1-3,5H2,(H,19,23)(H,20,24) |
| InChIKey | XSYMLXNDPUNRLE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |