C18H21N3O4S — CID 138002938
2-[4-(6-methyl-3-pyridinyl)piperidin-1-yl]-5-sulfamoylbenzoic acid (PubChem CID 138002938) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-[4-(6-methyl-3-pyridinyl)piperidin-1-yl]-5-sulfamoylbenzoic acid.
| Compound Name | 2-[4-(6-methyl-3-pyridinyl)piperidin-1-yl]-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 138002938 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-[4-(6-methyl-3-pyridinyl)piperidin-1-yl]-5-sulfamoylbenzoic acid |
| SMILES | Cc1ccc(C2CCN(c3ccc(S(N)(=O)=O)cc3C(=O)O)CC2)cn1 |
| InChI | InChI=1S/C18H21N3O4S/c1-12-2-3-14(11-20-12)13-6-8-21(9-7-13)17-5-4-15(26(19,24)25)10-16(17)18(22)23/h2-5,10-11,13H,6-9H2,1H3,(H,22,23)(H2,19,24,25) |
| InChIKey | OOVHUPAIYINFLA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |