C12H16N2O6S — CID 81195386
2-[2-(hydroxymethyl)morpholin-4-yl]-5-sulfamoylbenzoic acid (PubChem CID 81195386) has the molecular formula C12H16N2O6S and a molecular weight of 316.33 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)morpholin-4-yl]-5-sulfamoylbenzoic acid.
| Compound Name | 2-[2-(hydroxymethyl)morpholin-4-yl]-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 81195386 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-[2-(hydroxymethyl)morpholin-4-yl]-5-sulfamoylbenzoic acid |
| SMILES | NS(=O)(=O)c1ccc(N2CCOC(CO)C2)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H16N2O6S/c13-21(18,19)9-1-2-11(10(5-9)12(16)17)14-3-4-20-8(6-14)7-15/h1-2,5,8,15H,3-4,6-7H2,(H,16,17)(H2,13,18,19) |
| InChIKey | WSKUVCOSFUDODI-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |