C12H16N2O4 — CID 104500811
2-amino-4-[2-(hydroxymethyl)morpholin-4-yl]benzoic acid (PubChem CID 104500811) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-amino-4-[2-(hydroxymethyl)morpholin-4-yl]benzoic acid.
| Compound Name | 2-amino-4-[2-(hydroxymethyl)morpholin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 104500811 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 2-amino-4-[2-(hydroxymethyl)morpholin-4-yl]benzoic acid |
| SMILES | Nc1cc(N2CCOC(CO)C2)ccc1C(=O)O |
| InChI | InChI=1S/C12H16N2O4/c13-11-5-8(1-2-10(11)12(16)17)14-3-4-18-9(6-14)7-15/h1-2,5,9,15H,3-4,6-7,13H2,(H,16,17) |
| InChIKey | KWEDMELIQOEHOG-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|