C11H16N2O4S — CID 81219831
4-[2-(hydroxymethyl)morpholin-4-yl]benzenesulfonamide (PubChem CID 81219831) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is 4-[2-(hydroxymethyl)morpholin-4-yl]benzenesulfonamide.
| Compound Name | 4-[2-(hydroxymethyl)morpholin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 81219831 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-[2-(hydroxymethyl)morpholin-4-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2CCOC(CO)C2)cc1 |
| InChI | InChI=1S/C11H16N2O4S/c12-18(15,16)11-3-1-9(2-4-11)13-5-6-17-10(7-13)8-14/h1-4,10,14H,5-8H2,(H2,12,15,16) |
| InChIKey | IOSUWUFJHLRLNF-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |