C11H15FN2O4S — CID 81219360
3-fluoro-4-[2-(hydroxymethyl)morpholin-4-yl]benzenesulfonamide (PubChem CID 81219360) has the molecular formula C11H15FN2O4S and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-fluoro-4-[2-(hydroxymethyl)morpholin-4-yl]benzenesulfonamide.
| Compound Name | 3-fluoro-4-[2-(hydroxymethyl)morpholin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 81219360 |
| Molecular Formula | C11H15FN2O4S |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3-fluoro-4-[2-(hydroxymethyl)morpholin-4-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2CCOC(CO)C2)c(F)c1 |
| InChI | InChI=1S/C11H15FN2O4S/c12-10-5-9(19(13,16)17)1-2-11(10)14-3-4-18-8(6-14)7-15/h1-2,5,8,15H,3-4,6-7H2,(H2,13,16,17) |
| InChIKey | WWTYLBPVQFRPSG-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |