C18H19ClN2O5S — CID 94438401
methyl 2-[(2R)-2-(4-chlorophenyl)morpholin-4-yl]-5-sulfamoylbenzoate (PubChem CID 94438401) has the molecular formula C18H19ClN2O5S and a molecular weight of 410.88 g/mol. Its IUPAC name is methyl 2-[(2R)-2-(4-chlorophenyl)morpholin-4-yl]-5-sulfamoylbenzoate.
| Compound Name | methyl 2-[(2R)-2-(4-chlorophenyl)morpholin-4-yl]-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 94438401 |
| Molecular Formula | C18H19ClN2O5S |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | methyl 2-[(2R)-2-(4-chlorophenyl)morpholin-4-yl]-5-sulfamoylbenzoate |
| SMILES | COC(=O)c1cc(S(N)(=O)=O)ccc1N1CCO[C@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H19ClN2O5S/c1-25-18(22)15-10-14(27(20,23)24)6-7-16(15)21-8-9-26-17(11-21)12-2-4-13(19)5-3-12/h2-7,10,17H,8-9,11H2,1H3,(H2,20,23,24)/t17-/m0/s1 |
| InChIKey | MCKMRLAWTILFKQ-KRWDZBQOSA-N |
| XLogP | 2.35 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |