C17H20N6O2S — CID 138003023
1-[2-[(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]ethyl]triazole-4-carboxylic acid (PubChem CID 138003023) has the molecular formula C17H20N6O2S and a molecular weight of 372.45 g/mol. Its IUPAC name is 1-[2-[(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]ethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 138003023 |
| Molecular Formula | C17H20N6O2S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1-[2-[(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]ethyl]triazole-4-carboxylic acid |
| SMILES | Cc1nc(NCCn2cc(C(=O)O)nn2)c2c3c(sc2n1)CC(C)CC3 |
| InChI | InChI=1S/C17H20N6O2S/c1-9-3-4-11-13(7-9)26-16-14(11)15(19-10(2)20-16)18-5-6-23-8-12(17(24)25)21-22-23/h8-9H,3-7H2,1-2H3,(H,24,25)(H,18,19,20) |
| InChIKey | RBYAFGYBCJSDLI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |