C17H22N6OS — CID 167851043
2-[(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]-2-(4-methyl-1,2,4-triazol-3-yl)ethanol (PubChem CID 167851043) has the molecular formula C17H22N6OS and a molecular weight of 358.47 g/mol. Its IUPAC name is 2-[(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]-2-(4-methyl-1,2,4-triazol-3-yl)ethanol.
| Compound Name | 2-[(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]-2-(4-methyl-1,2,4-triazol-3-yl)ethanol |
|---|---|
| PubChem CID | 167851043 |
| Molecular Formula | C17H22N6OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2-[(2,7-dimethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]-2-(4-methyl-1,2,4-triazol-3-yl)ethanol |
| SMILES | Cc1nc(NC(CO)c2nncn2C)c2c3c(sc2n1)CC(C)CC3 |
| InChI | InChI=1S/C17H22N6OS/c1-9-4-5-11-13(6-9)25-17-14(11)15(19-10(2)20-17)21-12(7-24)16-22-18-8-23(16)3/h8-9,12,24H,4-7H2,1-3H3,(H,19,20,21) |
| InChIKey | IMURGTXYWSTCEP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |