C16H23FN4O — CID 138004925
1-[4-(5-fluoro-3-pyridinyl)piperazin-1-yl]-2-(3-methylpyrrolidin-1-yl)ethanone (PubChem CID 138004925) has the molecular formula C16H23FN4O and a molecular weight of 306.38 g/mol. Its IUPAC name is 1-[4-(5-fluoro-3-pyridinyl)piperazin-1-yl]-2-(3-methylpyrrolidin-1-yl)ethanone.
| Compound Name | 1-[4-(5-fluoro-3-pyridinyl)piperazin-1-yl]-2-(3-methylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 138004925 |
| Molecular Formula | C16H23FN4O |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-[4-(5-fluoro-3-pyridinyl)piperazin-1-yl]-2-(3-methylpyrrolidin-1-yl)ethanone |
| SMILES | CC1CCN(CC(=O)N2CCN(c3cncc(F)c3)CC2)C1 |
| InChI | InChI=1S/C16H23FN4O/c1-13-2-3-19(11-13)12-16(22)21-6-4-20(5-7-21)15-8-14(17)9-18-10-15/h8-10,13H,2-7,11-12H2,1H3 |
| InChIKey | FQEZGHPOBVIURE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |