C11H10F2N2OS — CID 138005886
5-[1-(2,3-difluorophenoxy)ethyl]-4-methylthiadiazole (PubChem CID 138005886) has the molecular formula C11H10F2N2OS and a molecular weight of 256.28 g/mol. Its IUPAC name is 5-[1-(2,3-difluorophenoxy)ethyl]-4-methylthiadiazole.
| Compound Name | 5-[1-(2,3-difluorophenoxy)ethyl]-4-methylthiadiazole |
|---|---|
| PubChem CID | 138005886 |
| Molecular Formula | C11H10F2N2OS |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 5-[1-(2,3-difluorophenoxy)ethyl]-4-methylthiadiazole |
| SMILES | Cc1nnsc1C(C)Oc1cccc(F)c1F |
| InChI | InChI=1S/C11H10F2N2OS/c1-6-11(17-15-14-6)7(2)16-9-5-3-4-8(12)10(9)13/h3-5,7H,1-2H3 |
| InChIKey | YKZLHNZXAIRTQB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |