C13H24N2O4S — CID 138005932
3-hydroxy-4,4-dimethoxy-N-[(1-methylsulfanylcyclopropyl)methyl]piperidine-1-carboxamide (PubChem CID 138005932) has the molecular formula C13H24N2O4S and a molecular weight of 304.41 g/mol. Its IUPAC name is 3-hydroxy-4,4-dimethoxy-N-[(1-methylsulfanylcyclopropyl)methyl]piperidine-1-carboxamide.
| Compound Name | 3-hydroxy-4,4-dimethoxy-N-[(1-methylsulfanylcyclopropyl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 138005932 |
| Molecular Formula | C13H24N2O4S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 3-hydroxy-4,4-dimethoxy-N-[(1-methylsulfanylcyclopropyl)methyl]piperidine-1-carboxamide |
| SMILES | COC1(OC)CCN(C(=O)NCC2(SC)CC2)CC1O |
| InChI | InChI=1S/C13H24N2O4S/c1-18-13(19-2)6-7-15(8-10(13)16)11(17)14-9-12(20-3)4-5-12/h10,16H,4-9H2,1-3H3,(H,14,17) |
| InChIKey | ZHJCPHRKRHITJN-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|