C14H23N5 — CID 138006730
N-[(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)methyl]-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[b]pyrrol-3a-amine (PubChem CID 138006730) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-[(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)methyl]-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[b]pyrrol-3a-amine.
| Compound Name | N-[(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)methyl]-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[b]pyrrol-3a-amine |
|---|---|
| PubChem CID | 138006730 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | N-[(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)methyl]-2,3,4,5,6,6a-hexahydro-1H-cyclopenta[b]pyrrol-3a-amine |
| SMILES | Cn1nc(C2CC2)nc1CNC12CCCC1NCC2 |
| InChI | InChI=1S/C14H23N5/c1-19-12(17-13(18-19)10-4-5-10)9-16-14-6-2-3-11(14)15-8-7-14/h10-11,15-16H,2-9H2,1H3 |
| InChIKey | PCTZHLJHBXTYKX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |