C17H19N5OS — CID 138008494
4-[4-(3-ethoxy-2-pyridinyl)piperazin-1-yl]thieno[3,2-d]pyrimidine (PubChem CID 138008494) has the molecular formula C17H19N5OS and a molecular weight of 341.44 g/mol. Its IUPAC name is 4-[4-(3-ethoxy-2-pyridinyl)piperazin-1-yl]thieno[3,2-d]pyrimidine.
| Compound Name | 4-[4-(3-ethoxy-2-pyridinyl)piperazin-1-yl]thieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 138008494 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-[4-(3-ethoxy-2-pyridinyl)piperazin-1-yl]thieno[3,2-d]pyrimidine |
| SMILES | CCOc1cccnc1N1CCN(c2ncnc3ccsc23)CC1 |
| InChI | InChI=1S/C17H19N5OS/c1-2-23-14-4-3-6-18-16(14)21-7-9-22(10-8-21)17-15-13(5-11-24-15)19-12-20-17/h3-6,11-12H,2,7-10H2,1H3 |
| InChIKey | KZSQKIZYOGAXJU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |