C15H16F2N4O — CID 138008917
N-(cyclopenten-1-ylmethyl)-7-(difluoromethyl)-5-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 138008917) has the molecular formula C15H16F2N4O and a molecular weight of 306.32 g/mol. Its IUPAC name is N-(cyclopenten-1-ylmethyl)-7-(difluoromethyl)-5-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-(cyclopenten-1-ylmethyl)-7-(difluoromethyl)-5-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 138008917 |
| Molecular Formula | C15H16F2N4O |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | N-(cyclopenten-1-ylmethyl)-7-(difluoromethyl)-5-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cc1cc(C(F)F)n2ncc(C(=O)NCC3=CCCC3)c2n1 |
| InChI | InChI=1S/C15H16F2N4O/c1-9-6-12(13(16)17)21-14(20-9)11(8-19-21)15(22)18-7-10-4-2-3-5-10/h4,6,8,13H,2-3,5,7H2,1H3,(H,18,22) |
| InChIKey | BJXWABJWOHTYGK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|