C15H11ClF2N4O2 — CID 19416210
N-(5-chloro-2-hydroxyphenyl)-7-(difluoromethyl)-5-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 19416210) has the molecular formula C15H11ClF2N4O2 and a molecular weight of 352.73 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-7-(difluoromethyl)-5-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-7-(difluoromethyl)-5-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 19416210 |
| Molecular Formula | C15H11ClF2N4O2 |
| Molecular Weight | 352.73 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-7-(difluoromethyl)-5-methylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cc1cc(C(F)F)n2ncc(C(=O)Nc3cc(Cl)ccc3O)c2n1 |
| InChI | InChI=1S/C15H11ClF2N4O2/c1-7-4-11(13(17)18)22-14(20-7)9(6-19-22)15(24)21-10-5-8(16)2-3-12(10)23/h2-6,13,23H,1H3,(H,21,24) |
| InChIKey | UNZOSEHISWDOAX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.73 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|