C14H11F2N5O2 — CID 1226150
7-(difluoromethyl)-N-(2-hydroxyphenyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 1226150) has the molecular formula C14H11F2N5O2 and a molecular weight of 319.27 g/mol. Its IUPAC name is 7-(difluoromethyl)-N-(2-hydroxyphenyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 7-(difluoromethyl)-N-(2-hydroxyphenyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 1226150 |
| Molecular Formula | C14H11F2N5O2 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 7-(difluoromethyl)-N-(2-hydroxyphenyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1cc(C(F)F)n2nc(C(=O)Nc3ccccc3O)nc2n1 |
| InChI | InChI=1S/C14H11F2N5O2/c1-7-6-9(11(15)16)21-14(17-7)19-12(20-21)13(23)18-8-4-2-3-5-10(8)22/h2-6,11,22H,1H3,(H,18,23) |
| InChIKey | NHHPMKTUUFHTNQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|