C17H19N5O4S — CID 30838933
N-[5-(dimethylsulfamoyl)-2-hydroxyphenyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 30838933) has the molecular formula C17H19N5O4S and a molecular weight of 389.44 g/mol. Its IUPAC name is N-[5-(dimethylsulfamoyl)-2-hydroxyphenyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-[5-(dimethylsulfamoyl)-2-hydroxyphenyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 30838933 |
| Molecular Formula | C17H19N5O4S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-[5-(dimethylsulfamoyl)-2-hydroxyphenyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cc1cc(C)n2ncc(C(=O)Nc3cc(S(=O)(=O)N(C)C)ccc3O)c2n1 |
| InChI | InChI=1S/C17H19N5O4S/c1-10-7-11(2)22-16(19-10)13(9-18-22)17(24)20-14-8-12(5-6-15(14)23)27(25,26)21(3)4/h5-9,23H,1-4H3,(H,20,24) |
| InChIKey | CLLPRLABSJJDIT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 116.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|