C15H17ClN4O3 — CID 138013222
methyl 2-[4-[3-[(4-chlorobenzoyl)amino]propyl]triazol-1-yl]acetate (PubChem CID 138013222) has the molecular formula C15H17ClN4O3 and a molecular weight of 336.78 g/mol. Its IUPAC name is methyl 2-[4-[3-[(4-chlorobenzoyl)amino]propyl]triazol-1-yl]acetate.
| Compound Name | methyl 2-[4-[3-[(4-chlorobenzoyl)amino]propyl]triazol-1-yl]acetate |
|---|---|
| PubChem CID | 138013222 |
| Molecular Formula | C15H17ClN4O3 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | methyl 2-[4-[3-[(4-chlorobenzoyl)amino]propyl]triazol-1-yl]acetate |
| SMILES | COC(=O)Cn1cc(CCCNC(=O)c2ccc(Cl)cc2)nn1 |
| InChI | InChI=1S/C15H17ClN4O3/c1-23-14(21)10-20-9-13(18-19-20)3-2-8-17-15(22)11-4-6-12(16)7-5-11/h4-7,9H,2-3,8,10H2,1H3,(H,17,22) |
| InChIKey | AMJAIMQDYRKYKG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|