C14H18ClNO5S — CID 138014607
1-[2-(3-chlorophenyl)ethylsulfonyl]-3-hydroxypiperidine-3-carboxylic acid (PubChem CID 138014607) has the molecular formula C14H18ClNO5S and a molecular weight of 347.82 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethylsulfonyl]-3-hydroxypiperidine-3-carboxylic acid.
| Compound Name | 1-[2-(3-chlorophenyl)ethylsulfonyl]-3-hydroxypiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 138014607 |
| Molecular Formula | C14H18ClNO5S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethylsulfonyl]-3-hydroxypiperidine-3-carboxylic acid |
| SMILES | O=C(O)C1(O)CCCN(S(=O)(=O)CCc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C14H18ClNO5S/c15-12-4-1-3-11(9-12)5-8-22(20,21)16-7-2-6-14(19,10-16)13(17)18/h1,3-4,9,19H,2,5-8,10H2,(H,17,18) |
| InChIKey | RWTGCAIVDSODFS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |