C19H27ClN2O4S — CID 118270811
tert-butyl (3aR,6aS)-5-[2-(3-chlorophenyl)ethylsulfonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carboxylate (PubChem CID 118270811) has the molecular formula C19H27ClN2O4S and a molecular weight of 414.96 g/mol. Its IUPAC name is tert-butyl (3aR,6aS)-5-[2-(3-chlorophenyl)ethylsulfonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aR,6aS)-5-[2-(3-chlorophenyl)ethylsulfonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 118270811 |
| Molecular Formula | C19H27ClN2O4S |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | tert-butyl (3aR,6aS)-5-[2-(3-chlorophenyl)ethylsulfonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CN(S(=O)(=O)CCc3cccc(Cl)c3)C[C@@H]2C1 |
| InChI | InChI=1S/C19H27ClN2O4S/c1-19(2,3)26-18(23)21-10-15-12-22(13-16(15)11-21)27(24,25)8-7-14-5-4-6-17(20)9-14/h4-6,9,15-16H,7-8,10-13H2,1-3H3/t15-,16+ |
| InChIKey | KMFSYFZFNLANNZ-IYBDPMFKSA-N |
| XLogP | 3.01 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |