C21H26F2N2O3 — CID 138015814
1-[(3aR,6aS)-1-acetylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1'-yl]-3-(2,5-difluorophenyl)propan-1-one (PubChem CID 138015814) has the molecular formula C21H26F2N2O3 and a molecular weight of 392.45 g/mol. Its IUPAC name is 1-[(3aR,6aS)-1-acetylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1'-yl]-3-(2,5-difluorophenyl)propan-1-one.
| Compound Name | 1-[(3aR,6aS)-1-acetylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1'-yl]-3-(2,5-difluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 138015814 |
| Molecular Formula | C21H26F2N2O3 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 1-[(3aR,6aS)-1-acetylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1'-yl]-3-(2,5-difluorophenyl)propan-1-one |
| SMILES | CC(=O)N1CC2(CCN(C(=O)CCc3cc(F)ccc3F)CC2)[C@H]2COC[C@H]21 |
| InChI | InChI=1S/C21H26F2N2O3/c1-14(26)25-13-21(17-11-28-12-19(17)25)6-8-24(9-7-21)20(27)5-2-15-10-16(22)3-4-18(15)23/h3-4,10,17,19H,2,5-9,11-13H2,1H3/t17-,19+/m0/s1 |
| InChIKey | ZBKRHJYUTNDEEN-PKOBYXMFSA-N |
| XLogP | 2.38 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |