C17H21ClN2O4 — CID 138015786
1-[(3aR,6aS)-1'-(2-chlorofuran-3-carbonyl)spiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]ethanone (PubChem CID 138015786) has the molecular formula C17H21ClN2O4 and a molecular weight of 352.82 g/mol. Its IUPAC name is 1-[(3aR,6aS)-1'-(2-chlorofuran-3-carbonyl)spiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]ethanone.
| Compound Name | 1-[(3aR,6aS)-1'-(2-chlorofuran-3-carbonyl)spiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]ethanone |
|---|---|
| PubChem CID | 138015786 |
| Molecular Formula | C17H21ClN2O4 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-[(3aR,6aS)-1'-(2-chlorofuran-3-carbonyl)spiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1-yl]ethanone |
| SMILES | CC(=O)N1CC2(CCN(C(=O)c3ccoc3Cl)CC2)[C@H]2COC[C@H]21 |
| InChI | InChI=1S/C17H21ClN2O4/c1-11(21)20-10-17(13-8-23-9-14(13)20)3-5-19(6-4-17)16(22)12-2-7-24-15(12)18/h2,7,13-14H,3-6,8-10H2,1H3/t13-,14+/m0/s1 |
| InChIKey | WSXGEDBGNQABGM-UONOGXRCSA-N |
| XLogP | 2.03 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |