C14H17ClN4O3 — CID 128981287
(2-chlorofuran-3-yl)-[3-hydroxy-3-(1-propan-2-yltriazol-4-yl)pyrrolidin-1-yl]methanone (PubChem CID 128981287) has the molecular formula C14H17ClN4O3 and a molecular weight of 324.77 g/mol. Its IUPAC name is (2-chlorofuran-3-yl)-[3-hydroxy-3-(1-propan-2-yltriazol-4-yl)pyrrolidin-1-yl]methanone.
| Compound Name | (2-chlorofuran-3-yl)-[3-hydroxy-3-(1-propan-2-yltriazol-4-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 128981287 |
| Molecular Formula | C14H17ClN4O3 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (2-chlorofuran-3-yl)-[3-hydroxy-3-(1-propan-2-yltriazol-4-yl)pyrrolidin-1-yl]methanone |
| SMILES | CC(C)n1cc(C2(O)CCN(C(=O)c3ccoc3Cl)C2)nn1 |
| InChI | InChI=1S/C14H17ClN4O3/c1-9(2)19-7-11(16-17-19)14(21)4-5-18(8-14)13(20)10-3-6-22-12(10)15/h3,6-7,9,21H,4-5,8H2,1-2H3 |
| InChIKey | UALSULNZEXDXIC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |