C17H19N5O2 — CID 129484088
4-[(3R)-3-hydroxy-3-(1-propan-2-yltriazol-4-yl)pyrrolidine-1-carbonyl]benzonitrile (PubChem CID 129484088) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 4-[(3R)-3-hydroxy-3-(1-propan-2-yltriazol-4-yl)pyrrolidine-1-carbonyl]benzonitrile.
| Compound Name | 4-[(3R)-3-hydroxy-3-(1-propan-2-yltriazol-4-yl)pyrrolidine-1-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 129484088 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 4-[(3R)-3-hydroxy-3-(1-propan-2-yltriazol-4-yl)pyrrolidine-1-carbonyl]benzonitrile |
| SMILES | CC(C)n1cc([C@@]2(O)CCN(C(=O)c3ccc(C#N)cc3)C2)nn1 |
| InChI | InChI=1S/C17H19N5O2/c1-12(2)22-10-15(19-20-22)17(24)7-8-21(11-17)16(23)14-5-3-13(9-18)4-6-14/h3-6,10,12,24H,7-8,11H2,1-2H3/t17-/m1/s1 |
| InChIKey | LXJLJFQHGXYISR-QGZVFWFLSA-N |
| XLogP | 1.46 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |