C17H26N6O2 — CID 128981852
[3-hydroxy-3-(1-propan-2-yltriazol-4-yl)piperidin-1-yl]-(1-propylpyrazol-4-yl)methanone (PubChem CID 128981852) has the molecular formula C17H26N6O2 and a molecular weight of 346.44 g/mol. Its IUPAC name is [3-hydroxy-3-(1-propan-2-yltriazol-4-yl)piperidin-1-yl]-(1-propylpyrazol-4-yl)methanone.
| Compound Name | [3-hydroxy-3-(1-propan-2-yltriazol-4-yl)piperidin-1-yl]-(1-propylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 128981852 |
| Molecular Formula | C17H26N6O2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | [3-hydroxy-3-(1-propan-2-yltriazol-4-yl)piperidin-1-yl]-(1-propylpyrazol-4-yl)methanone |
| SMILES | CCCn1cc(C(=O)N2CCCC(O)(c3cn(C(C)C)nn3)C2)cn1 |
| InChI | InChI=1S/C17H26N6O2/c1-4-7-22-10-14(9-18-22)16(24)21-8-5-6-17(25,12-21)15-11-23(13(2)3)20-19-15/h9-11,13,25H,4-8,12H2,1-3H3 |
| InChIKey | KIQJEHZVXGEZFE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |