C16H22N4O3 — CID 128981355
3-(furan-3-yl)-1-[3-hydroxy-3-(1-propan-2-yltriazol-4-yl)pyrrolidin-1-yl]propan-1-one (PubChem CID 128981355) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is 3-(furan-3-yl)-1-[3-hydroxy-3-(1-propan-2-yltriazol-4-yl)pyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-(furan-3-yl)-1-[3-hydroxy-3-(1-propan-2-yltriazol-4-yl)pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 128981355 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 3-(furan-3-yl)-1-[3-hydroxy-3-(1-propan-2-yltriazol-4-yl)pyrrolidin-1-yl]propan-1-one |
| SMILES | CC(C)n1cc(C2(O)CCN(C(=O)CCc3ccoc3)C2)nn1 |
| InChI | InChI=1S/C16H22N4O3/c1-12(2)20-9-14(17-18-20)16(22)6-7-19(11-16)15(21)4-3-13-5-8-23-10-13/h5,8-10,12,22H,3-4,6-7,11H2,1-2H3 |
| InChIKey | KTZTYIGMLOQMMW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |