C21H27N5O2 — CID 154788429
[(3aR,6aS)-1-ethylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1'-yl]-(2-pyrazol-1-yl-4-pyridinyl)methanone (PubChem CID 154788429) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is [(3aR,6aS)-1-ethylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1'-yl]-(2-pyrazol-1-yl-4-pyridinyl)methanone.
| Compound Name | [(3aR,6aS)-1-ethylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1'-yl]-(2-pyrazol-1-yl-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 154788429 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | [(3aR,6aS)-1-ethylspiro[3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3,4'-piperidine]-1'-yl]-(2-pyrazol-1-yl-4-pyridinyl)methanone |
| SMILES | CCN1CC2(CCN(C(=O)c3ccnc(-n4cccn4)c3)CC2)[C@H]2COC[C@H]21 |
| InChI | InChI=1S/C21H27N5O2/c1-2-24-15-21(17-13-28-14-18(17)24)5-10-25(11-6-21)20(27)16-4-8-22-19(12-16)26-9-3-7-23-26/h3-4,7-9,12,17-18H,2,5-6,10-11,13-15H2,1H3/t17-,18+/m0/s1 |
| InChIKey | FGXMHSFPGNCZFA-ZWKOTPCHSA-N |
| XLogP | 1.84 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |