C17H20N4O2 — CID 136567896
(3-cyclopropyl-3-methylmorpholin-4-yl)-(2-pyrazol-1-yl-4-pyridinyl)methanone (PubChem CID 136567896) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is (3-cyclopropyl-3-methylmorpholin-4-yl)-(2-pyrazol-1-yl-4-pyridinyl)methanone.
| Compound Name | (3-cyclopropyl-3-methylmorpholin-4-yl)-(2-pyrazol-1-yl-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 136567896 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (3-cyclopropyl-3-methylmorpholin-4-yl)-(2-pyrazol-1-yl-4-pyridinyl)methanone |
| SMILES | CC1(C2CC2)COCCN1C(=O)c1ccnc(-n2cccn2)c1 |
| InChI | InChI=1S/C17H20N4O2/c1-17(14-3-4-14)12-23-10-9-20(17)16(22)13-5-7-18-15(11-13)21-8-2-6-19-21/h2,5-8,11,14H,3-4,9-10,12H2,1H3 |
| InChIKey | WSMHLNCWHNPHIM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |